| Name | dimethoxymethylphenylsilane |
| Synonyms | Z 6073 Dimethoxyphenylmethylsilane methylphenyldimethoxysilane dimethoxymethylphenylsilane METHYLPHENYLDIMETHOXYSILANE dimethoxymethylphenyl-silan Fenyl-dimethoxy-methylsilan Methylphenyldimethoxysylane DIMETHOXYMETHYLPHENYLSILANE PHENYLMETHYLDIMETHOXYSILANE |
| CAS | 3027-21-2 |
| EINECS | 221-192-4 |
| InChI | InChI=1/C9H14O2Si/c1-10-12(11-2)8-9-6-4-3-5-7-9/h3-7,12H,8H2,1-2H3 |
| InChIKey | CVQVSVBUMVSJES-UHFFFAOYSA-N |
| Molecular Formula | C9H14O2Si |
| Molar Mass | 182.29 |
| Density | 1.005g/mLat 20°C(lit.) |
| Melting Point | 73-75 °C |
| Boling Point | 199°C(lit.) |
| Flash Point | 80 °C |
| Vapor Presure | 0.505mmHg at 25°C |
| Appearance | liquid |
| Specific Gravity | 0.993 |
| Color | colorless |
| Storage Condition | Inert atmosphere,Room Temperature |
| Sensitive | moisture sensitive |
| Refractive Index | n20/D 1.479 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | VV3645000 |
| FLUKA BRAND F CODES | 10-21 |
| TSCA | Yes |
| HS Code | 29319090 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| application | can be used as coupling agent, adhesion promoter, hydrophobic agent, dispersant, crosslinking agent, water removal agent, etc., with wide application. 1) Improve the thermal stability of other silanes. 2) Other silane or siloxane intermediates. 3) Hydrophobic surface treatment. |